C19H31N3O2 — CID 99633784
(4aS,8aS)-4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 99633784) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (4aS,8aS)-4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | (4aS,8aS)-4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 99633784 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (4aS,8aS)-4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | O=C1CN(CC(=O)N2CCC[C@@H]3CCCC[C@@H]32)[C@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C19H31N3O2/c23-18-12-21(17-10-4-2-8-15(17)20-18)13-19(24)22-11-5-7-14-6-1-3-9-16(14)22/h14-17H,1-13H2,(H,20,23)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | RIXQXNMSYVSWEZ-QAETUUGQSA-N |
| XLogP | 1.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |