C15H24N2O2S2 — CID 99634220
N-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 99634220) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 99634220 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | CCC1(CC)[C@@H](NC(=O)Cc2sc(=S)[nH]c2C)C[C@H]1OC |
| InChI | InChI=1S/C15H24N2O2S2/c1-5-15(6-2)11(8-12(15)19-4)17-13(18)7-10-9(3)16-14(20)21-10/h11-12H,5-8H2,1-4H3,(H,16,20)(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | BPOIJIHLXDOLSW-NWDGAFQWSA-N |
| XLogP | 3.37 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|