C16H16N2O4 — CID 99634320
methyl 1-[(2-cyclopropyl-1,3-benzoxazol-6-yl)carbamoyl]cyclopropane-1-carboxylate (PubChem CID 99634320) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl 1-[(2-cyclopropyl-1,3-benzoxazol-6-yl)carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[(2-cyclopropyl-1,3-benzoxazol-6-yl)carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 99634320 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 1-[(2-cyclopropyl-1,3-benzoxazol-6-yl)carbamoyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)Nc2ccc3nc(C4CC4)oc3c2)CC1 |
| InChI | InChI=1S/C16H16N2O4/c1-21-15(20)16(6-7-16)14(19)17-10-4-5-11-12(8-10)22-13(18-11)9-2-3-9/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,19) |
| InChIKey | UHRZEEWIHCKIBY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|