About 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one
5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one (PubChem CID 99634746) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one |
| PubChem CID | 99634746 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one |
| SMILES | O=c1ccc([N+](=O)[O-])cn1CCN[C@@H]1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H21N3O3/c22-18-10-9-15(21(23)24)13-20(18)12-11-19-17-8-4-7-16(17)14-5-2-1-3-6-14/h1-3,5-6,9-10,13,16-17,19H,4,7-8,11-12H2/t16-,17-/m1/s1 |
| InChIKey | BZSUCEKMSLOUSX-IAGOWNOFSA-N |
| XLogP | 2.68 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one?
The IUPAC name of 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one (CID 99634746) is 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one.
What is the SMILES notation for 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one?
The canonical SMILES for 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one is O=c1ccc([N+](=O)[O-])cn1CCN[C@@H]1CCC[C@@H]1c1ccccc1.
What is the InChIKey of 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one?
The InChIKey is BZSUCEKMSLOUSX-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H21N3O3/c22-18-10-9-15(21(23)24)13-20(18)12-11-19-17-8-4-7-16(17)14-5-2-1-3-6-14/h1-3,5-6,9-10,13,16-17,19H,4,7-8,11-12H2/t16-,17-/m1/s1.
What are the key properties of 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one?
5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one has a molecular weight of 327.38 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1-[2-[[(1R,2R)-2-phenylcyclopentyl]amino]ethyl]pyridin-2-one is sourced from PubChem (CID 99634746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).