C15H22N2O3 — CID 99635550
1-[(1R,2R)-2-hydroxycyclohexyl]-3-(3-methoxyphenyl)-1-methylurea (PubChem CID 99635550) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxycyclohexyl]-3-(3-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-(3-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 99635550 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-(3-methoxyphenyl)-1-methylurea |
| SMILES | COc1cccc(NC(=O)N(C)[C@@H]2CCCC[C@H]2O)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-17(13-8-3-4-9-14(13)18)15(19)16-11-6-5-7-12(10-11)20-2/h5-7,10,13-14,18H,3-4,8-9H2,1-2H3,(H,16,19)/t13-,14-/m1/s1 |
| InChIKey | CENMYTVGGRNPKA-ZIAGYGMSSA-N |
| XLogP | 2.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |