C22H28N4O3 — CID 99635730
tert-butyl 3-[2-oxo-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]ethylidene]azetidine-1-carboxylate (PubChem CID 99635730) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is tert-butyl 3-[2-oxo-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]ethylidene]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-oxo-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]ethylidene]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 99635730 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | tert-butyl 3-[2-oxo-2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]ethylidene]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC(=O)N2CCC(c3c[nH]c4ncccc34)CC2)C1 |
| InChI | InChI=1S/C22H28N4O3/c1-22(2,3)29-21(28)26-13-15(14-26)11-19(27)25-9-6-16(7-10-25)18-12-24-20-17(18)5-4-8-23-20/h4-5,8,11-12,16H,6-7,9-10,13-14H2,1-3H3,(H,23,24) |
| InChIKey | ZLGCZUCXLDKUGJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|