C16H22N2O5 — CID 99635860
(2-hydroxy-3-nitrophenyl)-[(4R)-4-propoxyazepan-1-yl]methanone (PubChem CID 99635860) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2-hydroxy-3-nitrophenyl)-[(4R)-4-propoxyazepan-1-yl]methanone.
| Compound Name | (2-hydroxy-3-nitrophenyl)-[(4R)-4-propoxyazepan-1-yl]methanone |
|---|---|
| PubChem CID | 99635860 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2-hydroxy-3-nitrophenyl)-[(4R)-4-propoxyazepan-1-yl]methanone |
| SMILES | CCCO[C@@H]1CCCN(C(=O)c2cccc([N+](=O)[O-])c2O)CC1 |
| InChI | InChI=1S/C16H22N2O5/c1-2-11-23-12-5-4-9-17(10-8-12)16(20)13-6-3-7-14(15(13)19)18(21)22/h3,6-7,12,19H,2,4-5,8-11H2,1H3/t12-/m1/s1 |
| InChIKey | RNKCXJCFFOFUKN-GFCCVEGCSA-N |
| XLogP | 2.72 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|