About N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide
N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide (PubChem CID 99637430) has the molecular formula C12H14N4O2S
and a molecular weight of 278.34 g/mol. Its IUPAC name is N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide.
Molecular Properties
| Compound Name | N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide |
| PubChem CID | 99637430 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide |
| SMILES | CCNC(=O)CC(=O)Nc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C12H14N4O2S/c1-2-13-10(17)6-11(18)14-7-3-4-8-9(5-7)16-12(19)15-8/h3-5H,2,6H2,1H3,(H,13,17)(H,14,18)(H2,15,16,19) |
| InChIKey | CDZBWTWHJCSYPM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide?
The IUPAC name of N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide (CID 99637430) is N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide.
What is the SMILES notation for N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide?
The canonical SMILES for N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide is CCNC(=O)CC(=O)Nc1ccc2[nH]c(=S)[nH]c2c1.
What is the InChIKey of N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide?
The InChIKey is CDZBWTWHJCSYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c1-2-13-10(17)6-11(18)14-7-3-4-8-9(5-7)16-12(19)15-8/h3-5H,2,6H2,1H3,(H,13,17)(H,14,18)(H2,15,16,19).
What are the key properties of N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide?
N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide has a molecular weight of 278.34 g/mol, XLogP of 1.69, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)propanediamide is sourced from PubChem (CID 99637430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).