C17H18N2O4S — CID 99638936
(3S)-1-[2-(1,3-thiazol-4-ylmethoxy)benzoyl]piperidine-3-carboxylic acid (PubChem CID 99638936) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is (3S)-1-[2-(1,3-thiazol-4-ylmethoxy)benzoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[2-(1,3-thiazol-4-ylmethoxy)benzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 99638936 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (3S)-1-[2-(1,3-thiazol-4-ylmethoxy)benzoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2ccccc2OCc2cscn2)C1 |
| InChI | InChI=1S/C17H18N2O4S/c20-16(19-7-3-4-12(8-19)17(21)22)14-5-1-2-6-15(14)23-9-13-10-24-11-18-13/h1-2,5-6,10-12H,3-4,7-9H2,(H,21,22)/t12-/m0/s1 |
| InChIKey | SNEJMAPLVSTWJO-LBPRGKRZSA-N |
| XLogP | 2.66 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |