C38H30N2O3 — CID 99640086
(4aR,6R)-7-benzoyl-6-methyl-2,3,4a-triphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one (PubChem CID 99640086) has the molecular formula C38H30N2O3 and a molecular weight of 562.67 g/mol. Its IUPAC name is (4aR,6R)-7-benzoyl-6-methyl-2,3,4a-triphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one.
| Compound Name | (4aR,6R)-7-benzoyl-6-methyl-2,3,4a-triphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one |
|---|---|
| PubChem CID | 99640086 |
| Molecular Formula | C38H30N2O3 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (4aR,6R)-7-benzoyl-6-methyl-2,3,4a-triphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one |
| SMILES | C[C@@H]1C[C@]2(c3ccccc3)OC(c3ccccc3)=C(c3ccccc3)C(=O)N2c2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H30N2O3/c1-27-26-38(31-22-12-5-13-23-31)40(33-25-15-14-24-32(33)39(27)36(41)30-20-10-4-11-21-30)37(42)34(28-16-6-2-7-17-28)35(43-38)29-18-8-3-9-19-29/h2-25,27H,26H2,1H3/t27-,38-/m1/s1 |
| InChIKey | LAHFUFPEVTXLAH-LTMKAIOCSA-N |
| XLogP | 7.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|