C38H29ClN2O3 — CID 99640402
(4aS,6S)-7-benzoyl-6-(4-chlorophenyl)-2-methyl-3,4a-diphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one (PubChem CID 99640402) has the molecular formula C38H29ClN2O3 and a molecular weight of 597.11 g/mol. Its IUPAC name is (4aS,6S)-7-benzoyl-6-(4-chlorophenyl)-2-methyl-3,4a-diphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one.
| Compound Name | (4aS,6S)-7-benzoyl-6-(4-chlorophenyl)-2-methyl-3,4a-diphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one |
|---|---|
| PubChem CID | 99640402 |
| Molecular Formula | C38H29ClN2O3 |
| Molecular Weight | 597.11 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | (4aS,6S)-7-benzoyl-6-(4-chlorophenyl)-2-methyl-3,4a-diphenyl-5,6-dihydro-[1,3]oxazino[3,2-a][1,5]benzodiazepin-1-one |
| SMILES | CC1=C(c2ccccc2)O[C@]2(c3ccccc3)C[C@@H](c3ccc(Cl)cc3)N(C(=O)c3ccccc3)c3ccccc3N2C1=O |
| InChI | InChI=1S/C38H29ClN2O3/c1-26-35(28-13-5-2-6-14-28)44-38(30-17-9-4-10-18-30)25-34(27-21-23-31(39)24-22-27)40(37(43)29-15-7-3-8-16-29)32-19-11-12-20-33(32)41(38)36(26)42/h2-24,34H,25H2,1H3/t34-,38-/m0/s1 |
| InChIKey | XVGYQMVCSVCWNH-UVNLRBHVSA-N |
| XLogP | 8.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.11 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |