C17H27NO3 — CID 99640572
(2R,5R)-4-(2,2-dimethoxyethyl)-2-(2,5-dimethylphenyl)-5-methylmorpholine (PubChem CID 99640572) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R,5R)-4-(2,2-dimethoxyethyl)-2-(2,5-dimethylphenyl)-5-methylmorpholine.
| Compound Name | (2R,5R)-4-(2,2-dimethoxyethyl)-2-(2,5-dimethylphenyl)-5-methylmorpholine |
|---|---|
| PubChem CID | 99640572 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (2R,5R)-4-(2,2-dimethoxyethyl)-2-(2,5-dimethylphenyl)-5-methylmorpholine |
| SMILES | COC(CN1C[C@@H](c2cc(C)ccc2C)OC[C@H]1C)OC |
| InChI | InChI=1S/C17H27NO3/c1-12-6-7-13(2)15(8-12)16-9-18(14(3)11-21-16)10-17(19-4)20-5/h6-8,14,16-17H,9-11H2,1-5H3/t14-,16+/m1/s1 |
| InChIKey | JOKFSXPBHNEGLX-ZBFHGGJFSA-N |
| XLogP | 2.68 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|