C13H18N6O3 — CID 99641325
N'-[8-(2-hydroxyethyl)-3,6-dimethyl-4,7-dioxopteridin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 99641325) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is N'-[8-(2-hydroxyethyl)-3,6-dimethyl-4,7-dioxopteridin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[8-(2-hydroxyethyl)-3,6-dimethyl-4,7-dioxopteridin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 99641325 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N'-[8-(2-hydroxyethyl)-3,6-dimethyl-4,7-dioxopteridin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1nc2c(=O)n(C)c(N=CN(C)C)nc2n(CCO)c1=O |
| InChI | InChI=1S/C13H18N6O3/c1-8-11(21)19(5-6-20)10-9(15-8)12(22)18(4)13(16-10)14-7-17(2)3/h7,20H,5-6H2,1-4H3 |
| InChIKey | RLBNJKZNRPFAIS-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|