C22H20F3N5 — CID 99641364
(8R,8aS)-5-amino-8-(2-cyanophenyl)-2-propyl-6-(trifluoromethyl)-1,3,8,8a-tetrahydroisoquinoline-7,7-dicarbonitrile (PubChem CID 99641364) has the molecular formula C22H20F3N5 and a molecular weight of 411.43 g/mol. Its IUPAC name is (8R,8aS)-5-amino-8-(2-cyanophenyl)-2-propyl-6-(trifluoromethyl)-1,3,8,8a-tetrahydroisoquinoline-7,7-dicarbonitrile.
| Compound Name | (8R,8aS)-5-amino-8-(2-cyanophenyl)-2-propyl-6-(trifluoromethyl)-1,3,8,8a-tetrahydroisoquinoline-7,7-dicarbonitrile |
|---|---|
| PubChem CID | 99641364 |
| Molecular Formula | C22H20F3N5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (8R,8aS)-5-amino-8-(2-cyanophenyl)-2-propyl-6-(trifluoromethyl)-1,3,8,8a-tetrahydroisoquinoline-7,7-dicarbonitrile |
| SMILES | CCCN1CC=C2C(N)=C(C(F)(F)F)C(C#N)(C#N)[C@@H](c3ccccc3C#N)[C@@H]2C1 |
| InChI | InChI=1S/C22H20F3N5/c1-2-8-30-9-7-16-17(11-30)18(15-6-4-3-5-14(15)10-26)21(12-27,13-28)20(19(16)29)22(23,24)25/h3-7,17-18H,2,8-9,11,29H2,1H3/t17-,18+/m1/s1 |
| InChIKey | UWBIQIDZAVDLNN-MSOLQXFVSA-N |
| XLogP | 3.73 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |