C20H17N3O5S — CID 99641584
(1R,5S,6S,7R)-3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-(1,3-thiazol-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 99641584) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is (1R,5S,6S,7R)-3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-(1,3-thiazol-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5S,6S,7R)-3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-(1,3-thiazol-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 99641584 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (1R,5S,6S,7R)-3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-(1,3-thiazol-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@@H]1[C@H]2C=C[C@@]3(CN(Cc4ccc5c(c4)OCO5)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C20H17N3O5S/c24-17(22-19-21-5-6-29-19)15-13-3-4-20(28-13)9-23(18(25)16(15)20)8-11-1-2-12-14(7-11)27-10-26-12/h1-7,13,15-16H,8-10H2,(H,21,22,24)/t13-,15-,16-,20+/m1/s1 |
| InChIKey | FSAQPVVOTUFKIP-CQNRTFJUSA-N |
| XLogP | 1.79 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|