About (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one
(5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one (PubChem CID 99645109) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one.
Molecular Properties
| Compound Name | (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
| PubChem CID | 99645109 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
| SMILES | O=C1NC[C@]2(CCNC2)O1 |
| InChI | InChI=1S/C6H10N2O2/c9-5-8-4-6(10-5)1-2-7-3-6/h7H,1-4H2,(H,8,9)/t6-/m1/s1 |
| InChIKey | OHCSTNUNQFZQJN-ZCFIWIBFSA-N |
| XLogP | -0.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
The IUPAC name of (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one (CID 99645109) is (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one.
What is the SMILES notation for (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
The canonical SMILES for (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one is O=C1NC[C@]2(CCNC2)O1.
What is the InChIKey of (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
The InChIKey is OHCSTNUNQFZQJN-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-5-8-4-6(10-5)1-2-7-3-6/h7H,1-4H2,(H,8,9)/t6-/m1/s1.
What are the key properties of (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one?
(5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one has a molecular weight of 142.16 g/mol, XLogP of -0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one is sourced from PubChem (CID 99645109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).