About (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one
(1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one (PubChem CID 99646032) has the molecular formula C11H9BrN2O
and a molecular weight of 265.11 g/mol. Its IUPAC name is (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one.
Molecular Properties
| Compound Name | (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one |
| PubChem CID | 99646032 |
| Molecular Formula | C11H9BrN2O |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one |
| SMILES | O=C1NN=C(c2ccc(Br)cc2)[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C11H9BrN2O/c12-7-3-1-6(2-4-7)10-8-5-9(8)11(15)14-13-10/h1-4,8-9H,5H2,(H,14,15)/t8-,9+/m0/s1 |
| InChIKey | LEKGSVBXCXKEQJ-DTWKUNHWSA-N |
| XLogP | 1.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
The IUPAC name of (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one (CID 99646032) is (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one.
What is the SMILES notation for (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
The canonical SMILES for (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one is O=C1NN=C(c2ccc(Br)cc2)[C@H]2C[C@@H]12.
What is the InChIKey of (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
The InChIKey is LEKGSVBXCXKEQJ-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H9BrN2O/c12-7-3-1-6(2-4-7)10-8-5-9(8)11(15)14-13-10/h1-4,8-9H,5H2,(H,14,15)/t8-,9+/m0/s1.
What are the key properties of (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
(1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one has a molecular weight of 265.11 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-5-(4-bromophenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one is sourced from PubChem (CID 99646032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).