C13H14N2O2 — CID 99646168
(1S,6S)-5-(4-ethoxyphenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one (PubChem CID 99646168) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (1S,6S)-5-(4-ethoxyphenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one.
| Compound Name | (1S,6S)-5-(4-ethoxyphenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one |
|---|---|
| PubChem CID | 99646168 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (1S,6S)-5-(4-ethoxyphenyl)-3,4-diazabicyclo[4.1.0]hept-4-en-2-one |
| SMILES | CCOc1ccc(C2=NNC(=O)[C@H]3C[C@H]23)cc1 |
| InChI | InChI=1S/C13H14N2O2/c1-2-17-9-5-3-8(4-6-9)12-10-7-11(10)13(16)15-14-12/h3-6,10-11H,2,7H2,1H3,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | VSPSLGHKWOMPGK-QWRGUYRKSA-N |
| XLogP | 1.56 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |