C9H16O — CID 99647050
trans-(2R,5S)-2-ethyl-5-methylcyclohexan-1-one (PubChem CID 99647050) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is trans-(2R,5S)-2-ethyl-5-methylcyclohexan-1-one.
| Compound Name | trans-(2R,5S)-2-ethyl-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 99647050 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | trans-(2R,5S)-2-ethyl-5-methylcyclohexan-1-one |
| SMILES | CC[C@@H]1CC[C@H](C)CC1=O |
| InChI | InChI=1S/C9H16O/c1-3-8-5-4-7(2)6-9(8)10/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | RVJFCLIBKNVRSI-JGVFFNPUSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |