C20H6Br2Cl12 — CID 99648198
(1S,2R,3R,4S,7S,8R,15S,16S)-11,12-dibromo-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene (PubChem CID 99648198) has the molecular formula C20H6Br2Cl12 and a molecular weight of 831.51 g/mol. Its IUPAC name is (1S,2R,3R,4S,7S,8R,15S,16S)-11,12-dibromo-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene.
| Compound Name | (1S,2R,3R,4S,7S,8R,15S,16S)-11,12-dibromo-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene |
|---|---|
| PubChem CID | 99648198 |
| Molecular Formula | C20H6Br2Cl12 |
| Molecular Weight | 831.51 g/mol |
| Exact Mass | 823.51 |
| IUPAC Name | (1S,2R,3R,4S,7S,8R,15S,16S)-11,12-dibromo-1,4,5,6,7,16,17,18,19,19,20,20-dodecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9,11,13,17-pentaene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@@H]3c4cc(Br)c(Br)cc4[C@H]4[C@@H]([C@H]3[C@@]1(Cl)C2(Cl)Cl)[C@]1(Cl)C(Cl)=C(Cl)[C@]4(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C20H6Br2Cl12/c21-5-1-3-4(2-6(5)22)8-10(18(30)14(26)12(24)16(8,28)20(18,33)34)9-7(3)15(27)11(23)13(25)17(9,29)19(15,31)32/h1-2,7-10H/t7-,8+,9-,10-,15-,16-,17-,18-/m0/s1 |
| InChIKey | KHPUTZCTTORBDN-YCYQBQBNSA-N |
| XLogP | 11.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.51 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|