C41H45F3N2O2 — CID 99650053
(2R,4aR,9aS)-N-(1-adamantyl)-2-[(2-phenylacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide (PubChem CID 99650053) has the molecular formula C41H45F3N2O2 and a molecular weight of 654.82 g/mol. Its IUPAC name is (2R,4aR,9aS)-N-(1-adamantyl)-2-[(2-phenylacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide.
| Compound Name | (2R,4aR,9aS)-N-(1-adamantyl)-2-[(2-phenylacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 99650053 |
| Molecular Formula | C41H45F3N2O2 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | (2R,4aR,9aS)-N-(1-adamantyl)-2-[(2-phenylacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]-3,4,4a,9,9a,10-hexahydro-1H-anthracene-2-carboxamide |
| SMILES | O=C(Cc1ccccc1)N(Cc1ccc(C(F)(F)F)cc1)[C@]1(C(=O)NC23CC4CC(CC(C4)C2)C3)CC[C@@H]2Cc3ccccc3C[C@H]2C1 |
| InChI | InChI=1S/C41H45F3N2O2/c42-41(43,44)36-12-10-28(11-13-36)26-46(37(47)19-27-6-2-1-3-7-27)40(15-14-34-20-32-8-4-5-9-33(32)21-35(34)25-40)38(48)45-39-22-29-16-30(23-39)18-31(17-29)24-39/h1-13,29-31,34-35H,14-26H2,(H,45,48)/t29?,30?,31?,34-,35+,39?,40-/m1/s1 |
| InChIKey | XWSTXZFHCZEUFP-IIZHKCFFSA-N |
| XLogP | 8.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |