C35H27ClFN3O5S — CID 99650850
ethyl (2E,5S)-5-(1,3-benzodioxol-5-yl)-2-[[1-(4-chloro-3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 99650850) has the molecular formula C35H27ClFN3O5S and a molecular weight of 656.14 g/mol. Its IUPAC name is ethyl (2E,5S)-5-(1,3-benzodioxol-5-yl)-2-[[1-(4-chloro-3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-5-(1,3-benzodioxol-5-yl)-2-[[1-(4-chloro-3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 99650850 |
| Molecular Formula | C35H27ClFN3O5S |
| Molecular Weight | 656.14 g/mol |
| Exact Mass | 655.13 |
| IUPAC Name | ethyl (2E,5S)-5-(1,3-benzodioxol-5-yl)-2-[[1-(4-chloro-3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C/c3cc(C)n(-c4ccc(Cl)c(F)c4)c3C)c(=O)n2[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H27ClFN3O5S/c1-4-43-34(42)30-31(21-8-6-5-7-9-21)38-35-40(32(30)22-10-13-27-28(15-22)45-18-44-27)33(41)29(46-35)16-23-14-19(2)39(20(23)3)24-11-12-25(36)26(37)17-24/h5-17,32H,4,18H2,1-3H3/b29-16+/t32-/m0/s1 |
| InChIKey | TWZULRLTBGOYKM-SLDXWZKBSA-N |
| XLogP | 5.86 |
| TPSA | 84.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.14 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|