C40H43Cl6N5 — CID 99652850
4-[(Z)-2-[2,6-bis[(Z)-2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]pyrimidin-4-yl]ethenyl]-N,N-bis(2-chloroethyl)aniline (PubChem CID 99652850) has the molecular formula C40H43Cl6N5 and a molecular weight of 806.54 g/mol. Its IUPAC name is 4-[(Z)-2-[2,6-bis[(Z)-2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]pyrimidin-4-yl]ethenyl]-N,N-bis(2-chloroethyl)aniline.
| Compound Name | 4-[(Z)-2-[2,6-bis[(Z)-2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]pyrimidin-4-yl]ethenyl]-N,N-bis(2-chloroethyl)aniline |
|---|---|
| PubChem CID | 99652850 |
| Molecular Formula | C40H43Cl6N5 |
| Molecular Weight | 806.54 g/mol |
| Exact Mass | 803.16 |
| IUPAC Name | 4-[(Z)-2-[2,6-bis[(Z)-2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]pyrimidin-4-yl]ethenyl]-N,N-bis(2-chloroethyl)aniline |
| SMILES | ClCCN(CCCl)c1ccc(/C=C\c2cc(/C=C\c3ccc(N(CCCl)CCCl)cc3)nc(/C=C\c3ccc(N(CCCl)CCCl)cc3)n2)cc1 |
| InChI | InChI=1S/C40H43Cl6N5/c41-19-25-49(26-20-42)37-12-3-32(4-13-37)1-10-35-31-36(11-2-33-5-14-38(15-6-33)50(27-21-43)28-22-44)48-40(47-35)18-9-34-7-16-39(17-8-34)51(29-23-45)30-24-46/h1-18,31H,19-30H2/b10-1-,11-2-,18-9- |
| InChIKey | ZWBYOFJBKIWIFV-PJBUVLOESA-N |
| XLogP | 10.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.54 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|