C28H8F14 — CID 99652908
1,2,3,4,5,6,7,8-octafluoro-9,10-bis[4-(trifluoromethyl)phenyl]anthracene (PubChem CID 99652908) has the molecular formula C28H8F14 and a molecular weight of 610.34 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octafluoro-9,10-bis[4-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octafluoro-9,10-bis[4-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 99652908 |
| Molecular Formula | C28H8F14 |
| Molecular Weight | 610.34 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octafluoro-9,10-bis[4-(trifluoromethyl)phenyl]anthracene |
| SMILES | Fc1c(F)c(F)c2c(-c3ccc(C(F)(F)F)cc3)c3c(F)c(F)c(F)c(F)c3c(-c3ccc(C(F)(F)F)cc3)c2c1F |
| InChI | InChI=1S/C28H8F14/c29-19-15-13(9-1-5-11(6-2-9)27(37,38)39)16-18(22(32)26(36)24(34)20(16)30)14(17(15)21(31)25(35)23(19)33)10-3-7-12(8-4-10)28(40,41)42/h1-8H |
| InChIKey | FFUQDRYCGMPMRR-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.34 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|