C16H15I3O5 — CID 99653316
(1S,6R)-6-[2-(2,4,6-triiodophenoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 99653316) has the molecular formula C16H15I3O5 and a molecular weight of 668.00 g/mol. Its IUPAC name is (1S,6R)-6-[2-(2,4,6-triiodophenoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[2-(2,4,6-triiodophenoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 99653316 |
| Molecular Formula | C16H15I3O5 |
| Molecular Weight | 668.00 g/mol |
| Exact Mass | 667.81 |
| IUPAC Name | (1S,6R)-6-[2-(2,4,6-triiodophenoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)OCCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C16H15I3O5/c17-9-7-12(18)14(13(19)8-9)23-5-6-24-16(22)11-4-2-1-3-10(11)15(20)21/h1-2,7-8,10-11H,3-6H2,(H,20,21)/t10-,11+/m0/s1 |
| InChIKey | AHTZPUQPYGNFAB-WDEREUQCSA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|