C25H28Cl8O4 — CID 99653713
(2R,3R,6R,7R,9S,10R,13S,14R)-3,4,5,6,10,11,12,13-octachloro-16,16,17,17-tetraethoxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadeca-4,11-diene (PubChem CID 99653713) has the molecular formula C25H28Cl8O4 and a molecular weight of 676.12 g/mol. Its IUPAC name is (2R,3R,6R,7R,9S,10R,13S,14R)-3,4,5,6,10,11,12,13-octachloro-16,16,17,17-tetraethoxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadeca-4,11-diene.
| Compound Name | (2R,3R,6R,7R,9S,10R,13S,14R)-3,4,5,6,10,11,12,13-octachloro-16,16,17,17-tetraethoxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadeca-4,11-diene |
|---|---|
| PubChem CID | 99653713 |
| Molecular Formula | C25H28Cl8O4 |
| Molecular Weight | 676.12 g/mol |
| Exact Mass | 671.95 |
| IUPAC Name | (2R,3R,6R,7R,9S,10R,13S,14R)-3,4,5,6,10,11,12,13-octachloro-16,16,17,17-tetraethoxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadeca-4,11-diene |
| SMILES | CCOC1(OCC)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)[C@@H]1C3CC([C@H]12)[C@@H]1[C@H]3[C@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(OCC)OCC |
| InChI | InChI=1S/C25H28Cl8O4/c1-5-34-24(35-6-2)20(30)12-10-9-11(13(12)21(24,31)17(27)16(20)26)15-14(10)22(32)18(28)19(29)23(15,33)25(22,36-7-3)37-8-4/h10-15H,5-9H2,1-4H3/t10?,11?,12-,13-,14-,15+,20+,21+,22-,23+/m1/s1 |
| InChIKey | JVFOFRUUBFJFSK-GRRSMQCKSA-N |
| XLogP | 7.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.12 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|