C23H36Cl6O6P2 — CID 99655128
4-[(R)-bis[(2R)-2-chlorobutoxy]phosphoryl-[[(2S)-1-chlorobutan-2-yl]-[(2S)-2-chlorobutoxy]phosphoryl]oxymethyl]-1,2-dichlorobenzene (PubChem CID 99655128) has the molecular formula C23H36Cl6O6P2 and a molecular weight of 683.20 g/mol. Its IUPAC name is 4-[(R)-bis[(2R)-2-chlorobutoxy]phosphoryl-[[(2S)-1-chlorobutan-2-yl]-[(2S)-2-chlorobutoxy]phosphoryl]oxymethyl]-1,2-dichlorobenzene.
| Compound Name | 4-[(R)-bis[(2R)-2-chlorobutoxy]phosphoryl-[[(2S)-1-chlorobutan-2-yl]-[(2S)-2-chlorobutoxy]phosphoryl]oxymethyl]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 99655128 |
| Molecular Formula | C23H36Cl6O6P2 |
| Molecular Weight | 683.20 g/mol |
| Exact Mass | 680.01 |
| IUPAC Name | 4-[(R)-bis[(2R)-2-chlorobutoxy]phosphoryl-[[(2S)-1-chlorobutan-2-yl]-[(2S)-2-chlorobutoxy]phosphoryl]oxymethyl]-1,2-dichlorobenzene |
| SMILES | CC[C@@H](Cl)COP(=O)(OC[C@H](Cl)CC)[C@@H](O[P@](=O)(OC[C@@H](Cl)CC)[C@@H](CC)CCl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H36Cl6O6P2/c1-5-17(25)13-32-36(30,20(8-4)12-24)35-23(16-9-10-21(28)22(29)11-16)37(31,33-14-18(26)6-2)34-15-19(27)7-3/h9-11,17-20,23H,5-8,12-15H2,1-4H3/t17-,18+,19+,20-,23+,36+/m0/s1 |
| InChIKey | HTNSEKFWRQMWCT-SXMDDATNSA-N |
| XLogP | 10.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.20 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|