C33H37N3O9S — CID 99655697
(2S)-2-[2-(3,4-dimethoxyphenyl)ethyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-2-(3-methoxyphenyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 99655697) has the molecular formula C33H37N3O9S and a molecular weight of 651.74 g/mol. Its IUPAC name is (2S)-2-[2-(3,4-dimethoxyphenyl)ethyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-2-(3-methoxyphenyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | (2S)-2-[2-(3,4-dimethoxyphenyl)ethyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-2-(3-methoxyphenyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 99655697 |
| Molecular Formula | C33H37N3O9S |
| Molecular Weight | 651.74 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | (2S)-2-[2-(3,4-dimethoxyphenyl)ethyl-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-2-(3-methoxyphenyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | COc1cccc([C@@H](C(=O)NC[C@H]2CCCO2)N(CCc2ccc(OC)c(OC)c2)C(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C33H37N3O9S/c1-42-24-9-6-8-23(19-24)31(32(38)34-20-25-10-7-17-45-25)35(16-15-22-13-14-27(43-2)28(18-22)44-3)30(37)21-36-33(39)26-11-4-5-12-29(26)46(36,40)41/h4-6,8-9,11-14,18-19,25,31H,7,10,15-17,20-21H2,1-3H3,(H,34,38)/t25-,31+/m1/s1 |
| InChIKey | QGTCUPKHOAXFSR-NJHZRGNWSA-N |
| XLogP | 2.96 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |