C33H33NO10S — CID 99656263
(7R,9S)-7-[(2R,4R,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-9-(2-phenylsulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 99656263) has the molecular formula C33H33NO10S and a molecular weight of 635.69 g/mol. Its IUPAC name is (7R,9S)-7-[(2R,4R,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-9-(2-phenylsulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R,9S)-7-[(2R,4R,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-9-(2-phenylsulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 99656263 |
| Molecular Formula | C33H33NO10S |
| Molecular Weight | 635.69 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | (7R,9S)-7-[(2R,4R,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-9-(2-phenylsulfanylacetyl)-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CSc1ccccc1)C[C@H]3O[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C33H33NO10S/c1-15-28(36)19(34)11-23(43-15)44-21-13-33(41,22(35)14-45-16-7-4-3-5-8-16)12-18-25(21)32(40)27-26(30(18)38)29(37)17-9-6-10-20(42-2)24(17)31(27)39/h3-10,15,19,21,23,28,36,38,40-41H,11-14,34H2,1-2H3/t15-,19+,21+,23-,28-,33-/m0/s1 |
| InChIKey | WXRBTXBZCINPCH-CYROPTILSA-N |
| XLogP | 2.80 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|