C32H34N6O8S2 — CID 99657084
diethyl 3-methyl-5-[[(2S)-2-[[5-[[(4-nitrobenzoyl)amino]methyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 99657084) has the molecular formula C32H34N6O8S2 and a molecular weight of 694.79 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[(2S)-2-[[5-[[(4-nitrobenzoyl)amino]methyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[(2S)-2-[[5-[[(4-nitrobenzoyl)amino]methyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 99657084 |
| Molecular Formula | C32H34N6O8S2 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | diethyl 3-methyl-5-[[(2S)-2-[[5-[[(4-nitrobenzoyl)amino]methyl]-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)[C@H](C)Sc2nnc(CNC(=O)c3ccc([N+](=O)[O-])cc3)n2CCc2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C32H34N6O8S2/c1-5-45-30(41)25-19(3)26(31(42)46-6-2)48-29(25)34-27(39)20(4)47-32-36-35-24(37(32)17-16-21-10-8-7-9-11-21)18-33-28(40)22-12-14-23(15-13-22)38(43)44/h7-15,20H,5-6,16-18H2,1-4H3,(H,33,40)(H,34,39)/t20-/m0/s1 |
| InChIKey | WEAZQLBUEDQIKG-FQEVSTJZSA-N |
| XLogP | 5.20 |
| TPSA | 184.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|