C34H27N5O6S — CID 99658099
prop-2-enyl (2Z,5R)-5-(4-methoxyphenyl)-7-methyl-2-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 99658099) has the molecular formula C34H27N5O6S and a molecular weight of 633.69 g/mol. Its IUPAC name is prop-2-enyl (2Z,5R)-5-(4-methoxyphenyl)-7-methyl-2-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl (2Z,5R)-5-(4-methoxyphenyl)-7-methyl-2-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 99658099 |
| Molecular Formula | C34H27N5O6S |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.17 |
| IUPAC Name | prop-2-enyl (2Z,5R)-5-(4-methoxyphenyl)-7-methyl-2-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2s/c(=C\c3cn(-c4ccccc4)nc3-c3cccc([N+](=O)[O-])c3)c(=O)n2[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H27N5O6S/c1-4-17-45-33(41)29-21(2)35-34-38(31(29)22-13-15-27(44-3)16-14-22)32(40)28(46-34)19-24-20-37(25-10-6-5-7-11-25)36-30(24)23-9-8-12-26(18-23)39(42)43/h4-16,18-20,31H,1,17H2,2-3H3/b28-19-/t31-/m1/s1 |
| InChIKey | YXICJMYZRHNDNI-KUSDHMTMSA-N |
| XLogP | 4.73 |
| TPSA | 130.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|