C35H34N6O6S2 — CID 99660387
N-[[5-[2-[(3R)-3-(2,3-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 99660387) has the molecular formula C35H34N6O6S2 and a molecular weight of 698.83 g/mol. Its IUPAC name is N-[[5-[2-[(3R)-3-(2,3-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[5-[2-[(3R)-3-(2,3-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 99660387 |
| Molecular Formula | C35H34N6O6S2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.20 |
| IUPAC Name | N-[[5-[2-[(3R)-3-(2,3-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2nnc(SCC(=O)N3N=C(c4cccs4)C[C@@H]3c3cccc(OC)c3OC)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C35H34N6O6S2/c1-44-27-16-15-22(18-29(27)46-3)34(43)36-20-31-37-38-35(40(31)23-10-6-5-7-11-23)49-21-32(42)41-26(19-25(39-41)30-14-9-17-48-30)24-12-8-13-28(45-2)33(24)47-4/h5-18,26H,19-21H2,1-4H3,(H,36,43)/t26-/m1/s1 |
| InChIKey | BAYVJIJFPGIHPD-AREMUKBSSA-N |
| XLogP | 5.76 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |