C64H55BrO5 — CID 99661391
(2R,3S,4R,5S,6S)-2-(bromomethyl)-6-methoxy-3,4,5-tritrityloxyoxane (PubChem CID 99661391) has the molecular formula C64H55BrO5 and a molecular weight of 984.04 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-(bromomethyl)-6-methoxy-3,4,5-tritrityloxyoxane.
| Compound Name | (2R,3S,4R,5S,6S)-2-(bromomethyl)-6-methoxy-3,4,5-tritrityloxyoxane |
|---|---|
| PubChem CID | 99661391 |
| Molecular Formula | C64H55BrO5 |
| Molecular Weight | 984.04 g/mol |
| Exact Mass | 982.32 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-(bromomethyl)-6-methoxy-3,4,5-tritrityloxyoxane |
| SMILES | CO[C@H]1O[C@@H](CBr)[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C64H55BrO5/c1-66-61-60(70-64(54-41-23-8-24-42-54,55-43-25-9-26-44-55)56-45-27-10-28-46-56)59(69-63(51-35-17-5-18-36-51,52-37-19-6-20-38-52)53-39-21-7-22-40-53)58(57(47-65)67-61)68-62(48-29-11-2-12-30-48,49-31-13-3-14-32-49)50-33-15-4-16-34-50/h2-46,57-61H,47H2,1H3/t57-,58+,59+,60-,61-/m0/s1 |
| InChIKey | ZJEJBLWGAZBXNH-XLYJHUFYSA-N |
| XLogP | 13.88 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.04 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|