C32H26Cl2N4O6 — CID 99663730
N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[[(2R,3S)-3-[4-[[(Z)-(4-chlorophenyl)methylideneamino]carbamoyl]phenoxy]-1,4-dioxan-2-yl]oxy]benzamide (PubChem CID 99663730) has the molecular formula C32H26Cl2N4O6 and a molecular weight of 633.49 g/mol. Its IUPAC name is N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[[(2R,3S)-3-[4-[[(Z)-(4-chlorophenyl)methylideneamino]carbamoyl]phenoxy]-1,4-dioxan-2-yl]oxy]benzamide.
| Compound Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[[(2R,3S)-3-[4-[[(Z)-(4-chlorophenyl)methylideneamino]carbamoyl]phenoxy]-1,4-dioxan-2-yl]oxy]benzamide |
|---|---|
| PubChem CID | 99663730 |
| Molecular Formula | C32H26Cl2N4O6 |
| Molecular Weight | 633.49 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[[(2R,3S)-3-[4-[[(Z)-(4-chlorophenyl)methylideneamino]carbamoyl]phenoxy]-1,4-dioxan-2-yl]oxy]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1)c1ccc(O[C@H]2OCCO[C@H]2Oc2ccc(C(=O)N/N=C\c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26Cl2N4O6/c33-25-9-1-21(2-10-25)19-35-37-29(39)23-5-13-27(14-6-23)43-31-32(42-18-17-41-31)44-28-15-7-24(8-16-28)30(40)38-36-20-22-3-11-26(34)12-4-22/h1-16,19-20,31-32H,17-18H2,(H,37,39)(H,38,40)/b35-19-,36-20-/t31-,32+ |
| InChIKey | MLPKIYDBTAYESS-NVUKRBABSA-N |
| XLogP | 5.68 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|