C29H26Br2N3O6PS — CID 99664195
N-[(2,4-dibromophenoxy)-(5-methylfuran-2-yl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanylidene]-4-nitrobenzenesulfonamide (PubChem CID 99664195) has the molecular formula C29H26Br2N3O6PS and a molecular weight of 735.39 g/mol. Its IUPAC name is N-[(2,4-dibromophenoxy)-(5-methylfuran-2-yl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanylidene]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2,4-dibromophenoxy)-(5-methylfuran-2-yl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanylidene]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 99664195 |
| Molecular Formula | C29H26Br2N3O6PS |
| Molecular Weight | 735.39 g/mol |
| Exact Mass | 732.96 |
| IUPAC Name | N-[(2,4-dibromophenoxy)-(5-methylfuran-2-yl)-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanylidene]-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([P@@](/C=C2\N(C)c3ccccc3C2(C)C)(=NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)Oc2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C29H26Br2N3O6PS/c1-19-9-16-28(39-19)41(40-26-15-10-20(30)17-24(26)31,32-42(37,38)22-13-11-21(12-14-22)34(35)36)18-27-29(2,3)23-7-5-6-8-25(23)33(27)4/h5-18H,1-4H3/b27-18-/t41-/m0/s1 |
| InChIKey | PXZVVROGUUQINO-KREHPSRISA-N |
| XLogP | 8.50 |
| TPSA | 115.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.39 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|