C36H35BrN6O6 — CID 99673420
2-bromo-5-methoxy-N-[5-[4-(4-nitrophenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide (PubChem CID 99673420) has the molecular formula C36H35BrN6O6 and a molecular weight of 727.62 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-[5-[4-(4-nitrophenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide.
| Compound Name | 2-bromo-5-methoxy-N-[5-[4-(4-nitrophenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 99673420 |
| Molecular Formula | C36H35BrN6O6 |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 726.18 |
| IUPAC Name | 2-bromo-5-methoxy-N-[5-[4-(4-nitrophenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide |
| SMILES | COc1ccc(Br)c(C(=O)Nc2cc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)ccc2N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)c1 |
| InChI | InChI=1S/C36H35BrN6O6/c1-49-28-10-11-30(37)29(19-28)35(45)38-31-18-24(36(46)40-15-13-39(14-16-40)26-6-8-27(9-7-26)43(47)48)5-12-33(31)41-20-23-17-25(22-41)32-3-2-4-34(44)42(32)21-23/h2-12,18-19,23,25H,13-17,20-22H2,1H3,(H,38,45)/t23-,25+/m1/s1 |
| InChIKey | UYWPTBLXXZIFKO-NOZRDPDXSA-N |
| XLogP | 5.37 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|