C26H17Br3N2O3 — CID 99685337
(4R,7S)-2-amino-5-oxo-7-phenyl-4-[5-(2,4,6-tribromophenyl)furan-2-yl]-4,6,7,8-tetrahydrochromene-3-carbonitrile (PubChem CID 99685337) has the molecular formula C26H17Br3N2O3 and a molecular weight of 645.15 g/mol. Its IUPAC name is (4R,7S)-2-amino-5-oxo-7-phenyl-4-[5-(2,4,6-tribromophenyl)furan-2-yl]-4,6,7,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4R,7S)-2-amino-5-oxo-7-phenyl-4-[5-(2,4,6-tribromophenyl)furan-2-yl]-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 99685337 |
| Molecular Formula | C26H17Br3N2O3 |
| Molecular Weight | 645.15 g/mol |
| Exact Mass | 641.88 |
| IUPAC Name | (4R,7S)-2-amino-5-oxo-7-phenyl-4-[5-(2,4,6-tribromophenyl)furan-2-yl]-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)C[C@@H](c3ccccc3)C2)[C@@H]1c1ccc(-c2c(Br)cc(Br)cc2Br)o1 |
| InChI | InChI=1S/C26H17Br3N2O3/c27-15-10-17(28)24(18(29)11-15)21-7-6-20(33-21)23-16(12-30)26(31)34-22-9-14(8-19(32)25(22)23)13-4-2-1-3-5-13/h1-7,10-11,14,23H,8-9,31H2/t14-,23+/m1/s1 |
| InChIKey | KFCHQVXMTNDAJF-FATZIPQQSA-N |
| XLogP | 7.44 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.15 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |