C38H39N7O3 — CID 99686498
4-N,4-N-diethyl-1-N-[(17S)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-yl]benzene-1,4-diamine (PubChem CID 99686498) has the molecular formula C38H39N7O3 and a molecular weight of 641.78 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-[(17S)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-yl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-[(17S)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 99686498 |
| Molecular Formula | C38H39N7O3 |
| Molecular Weight | 641.78 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-[(17S)-15-methyl-13-phenyl-17-(3,4,5-trimethoxyphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-yl]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2=Nc3ccccc3N3C2=Nc2c(c(C)nn2-c2ccccc2)[C@@H]3c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C38H39N7O3/c1-7-43(8-2)27-20-18-26(19-21-27)39-36-38-41-37-33(24(3)42-45(37)28-14-10-9-11-15-28)34(44(38)30-17-13-12-16-29(30)40-36)25-22-31(46-4)35(48-6)32(23-25)47-5/h9-23,34H,7-8H2,1-6H3,(H,39,40)/t34-/m0/s1 |
| InChIKey | UBPJQRBGZMSVOG-UMSFTDKQSA-N |
| XLogP | 7.85 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.78 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|