C36H36Cl2N2O7S — CID 99687901
ethyl (2E,5R)-5-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-2-[(3,4-diethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 99687901) has the molecular formula C36H36Cl2N2O7S and a molecular weight of 711.66 g/mol. Its IUPAC name is ethyl (2E,5R)-5-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-2-[(3,4-diethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-5-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-2-[(3,4-diethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 99687901 |
| Molecular Formula | C36H36Cl2N2O7S |
| Molecular Weight | 711.66 g/mol |
| Exact Mass | 710.16 |
| IUPAC Name | ethyl (2E,5R)-5-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-2-[(3,4-diethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(OCC)c(OCC)c3)c(=O)n2[C@@H]1c1ccc(OCc2ccc(Cl)cc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C36H36Cl2N2O7S/c1-6-43-27-14-10-22(16-29(27)44-7-2)17-31-34(41)40-33(32(35(42)46-9-4)21(5)39-36(40)48-31)23-12-15-28(30(18-23)45-8-3)47-20-24-11-13-25(37)19-26(24)38/h10-19,33H,6-9,20H2,1-5H3/b31-17+/t33-/m1/s1 |
| InChIKey | WSDBSPWZGPXEJR-YIDORKBYSA-N |
| XLogP | 6.88 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |