C38H31N7O6S2 — CID 99690533
N-[(E)-[1-(2-acetylanilino)-4-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-1,4-dioxobutan-2-ylidene]amino]-2-sulfamoylbenzamide (PubChem CID 99690533) has the molecular formula C38H31N7O6S2 and a molecular weight of 745.84 g/mol. Its IUPAC name is N-[(E)-[1-(2-acetylanilino)-4-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-1,4-dioxobutan-2-ylidene]amino]-2-sulfamoylbenzamide.
| Compound Name | N-[(E)-[1-(2-acetylanilino)-4-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-1,4-dioxobutan-2-ylidene]amino]-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 99690533 |
| Molecular Formula | C38H31N7O6S2 |
| Molecular Weight | 745.84 g/mol |
| Exact Mass | 745.18 |
| IUPAC Name | N-[(E)-[1-(2-acetylanilino)-4-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-1,4-dioxobutan-2-ylidene]amino]-2-sulfamoylbenzamide |
| SMILES | CC(=O)c1ccccc1NC(=O)/C(CC(=O)c1sc(-n2nc(-c3ccccc3)cc2-c2ccccc2)nc1C)=N/NC(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C38H31N7O6S2/c1-23-35(52-38(40-23)45-32(26-15-7-4-8-16-26)21-30(44-45)25-13-5-3-6-14-25)33(47)22-31(37(49)41-29-19-11-9-17-27(29)24(2)46)42-43-36(48)28-18-10-12-20-34(28)53(39,50)51/h3-21H,22H2,1-2H3,(H,41,49)(H,43,48)(H2,39,50,51)/b42-31+ |
| InChIKey | ISWWGUXWIOCRKT-FEMONOMJSA-N |
| XLogP | 5.82 |
| TPSA | 195.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|