C15H8Cl3F20NO2 — CID 99692173
N-[(1S)-2,2,2-trichloro-1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecoxy)ethyl]acetamide (PubChem CID 99692173) has the molecular formula C15H8Cl3F20NO2 and a molecular weight of 720.55 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecoxy)ethyl]acetamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 99692173 |
| Molecular Formula | C15H8Cl3F20NO2 |
| Molecular Weight | 720.55 g/mol |
| Exact Mass | 718.93 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecoxy)ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H8Cl3F20NO2/c1-3(40)39-5(8(16,17)18)41-2-6(21,22)9(25,26)11(29,30)13(33,34)15(37,38)14(35,36)12(31,32)10(27,28)7(23,24)4(19)20/h4-5H,2H2,1H3,(H,39,40)/t5-/m0/s1 |
| InChIKey | OEVLNYFTRAVIFO-YFKPBYRVSA-N |
| XLogP | 7.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.55 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|