C28H32Cl6N2O8 — CID 99693766
N-[(1S)-1-[25-[(1S)-1-acetamido-2,2,2-trichloroethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-2,2,2-trichloroethyl]acetamide (PubChem CID 99693766) has the molecular formula C28H32Cl6N2O8 and a molecular weight of 737.29 g/mol. Its IUPAC name is N-[(1S)-1-[25-[(1S)-1-acetamido-2,2,2-trichloroethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-2,2,2-trichloroethyl]acetamide.
| Compound Name | N-[(1S)-1-[25-[(1S)-1-acetamido-2,2,2-trichloroethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-2,2,2-trichloroethyl]acetamide |
|---|---|
| PubChem CID | 99693766 |
| Molecular Formula | C28H32Cl6N2O8 |
| Molecular Weight | 737.29 g/mol |
| Exact Mass | 734.03 |
| IUPAC Name | N-[(1S)-1-[25-[(1S)-1-acetamido-2,2,2-trichloroethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]-2,2,2-trichloroethyl]acetamide |
| SMILES | CC(=O)N[C@@H](c1ccc2c(c1)OCCOCCOc1cc([C@H](NC(C)=O)C(Cl)(Cl)Cl)ccc1OCCOCCO2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H32Cl6N2O8/c1-17(37)35-25(27(29,30)31)19-3-5-21-23(15-19)43-13-9-40-10-14-44-24-16-20(26(28(32,33)34)36-18(2)38)4-6-22(24)42-12-8-39-7-11-41-21/h3-6,15-16,25-26H,7-14H2,1-2H3,(H,35,37)(H,36,38)/t25-,26-/m0/s1 |
| InChIKey | RDUATVXGUFYFDR-UIOOFZCWSA-N |
| XLogP | 6.04 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.29 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|