C27H23Br2F3N4O — CID 99695343
1-[(3R,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 99695343) has the molecular formula C27H23Br2F3N4O and a molecular weight of 636.31 g/mol. Its IUPAC name is 1-[(3R,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(3R,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 99695343 |
| Molecular Formula | C27H23Br2F3N4O |
| Molecular Weight | 636.31 g/mol |
| Exact Mass | 634.02 |
| IUPAC Name | 1-[(3R,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1N=C2/C(=C\c3ccc(Br)cc3)CCC[C@@H]2[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H23Br2F3N4O/c1-16-13-23(27(30,31)32)33-35(16)15-24(37)36-26(18-7-11-21(29)12-8-18)22-4-2-3-19(25(22)34-36)14-17-5-9-20(28)10-6-17/h5-14,22,26H,2-4,15H2,1H3/b19-14-/t22-,26-/m0/s1 |
| InChIKey | UGBGNHPXQWDEON-MNNLXPHHSA-N |
| XLogP | 7.56 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.31 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |