C13H16N2O5 — CID 99695566
[(2S,3R)-2,3-dimethylmorpholin-4-yl]-(3-hydroxy-4-nitrophenyl)methanone (PubChem CID 99695566) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is [(2S,3R)-2,3-dimethylmorpholin-4-yl]-(3-hydroxy-4-nitrophenyl)methanone.
| Compound Name | [(2S,3R)-2,3-dimethylmorpholin-4-yl]-(3-hydroxy-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 99695566 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [(2S,3R)-2,3-dimethylmorpholin-4-yl]-(3-hydroxy-4-nitrophenyl)methanone |
| SMILES | C[C@@H]1OCCN(C(=O)c2ccc([N+](=O)[O-])c(O)c2)[C@@H]1C |
| InChI | InChI=1S/C13H16N2O5/c1-8-9(2)20-6-5-14(8)13(17)10-3-4-11(15(18)19)12(16)7-10/h3-4,7-9,16H,5-6H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | NFQCJWCIVXGNQD-BDAKNGLRSA-N |
| XLogP | 1.55 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|