C15H21N5OS — CID 99695946
cis-(1S,2R)-2-amino-N'-thieno[3,2-d]pyrimidin-4-ylcyclooctane-1-carbohydrazide (PubChem CID 99695946) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is cis-(1S,2R)-2-amino-N'-thieno[3,2-d]pyrimidin-4-ylcyclooctane-1-carbohydrazide.
| Compound Name | cis-(1S,2R)-2-amino-N'-thieno[3,2-d]pyrimidin-4-ylcyclooctane-1-carbohydrazide |
|---|---|
| PubChem CID | 99695946 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | cis-(1S,2R)-2-amino-N'-thieno[3,2-d]pyrimidin-4-ylcyclooctane-1-carbohydrazide |
| SMILES | N[C@@H]1CCCCCC[C@@H]1C(=O)NNc1ncnc2ccsc12 |
| InChI | InChI=1S/C15H21N5OS/c16-11-6-4-2-1-3-5-10(11)15(21)20-19-14-13-12(7-8-22-13)17-9-18-14/h7-11H,1-6,16H2,(H,20,21)(H,17,18,19)/t10-,11+/m0/s1 |
| InChIKey | AGZRZVZGSVXPCQ-WDEREUQCSA-N |
| XLogP | 2.43 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|