C20H35N3O — CID 99696313
2-[4-[[(1R,2S)-2-(cyclohexen-1-yl)cyclohexyl]amino]piperidin-1-yl]-N-methylacetamide (PubChem CID 99696313) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-[4-[[(1R,2S)-2-(cyclohexen-1-yl)cyclohexyl]amino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[[(1R,2S)-2-(cyclohexen-1-yl)cyclohexyl]amino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 99696313 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 2-[4-[[(1R,2S)-2-(cyclohexen-1-yl)cyclohexyl]amino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(N[C@@H]2CCCC[C@H]2C2=CCCCC2)CC1 |
| InChI | InChI=1S/C20H35N3O/c1-21-20(24)15-23-13-11-17(12-14-23)22-19-10-6-5-9-18(19)16-7-3-2-4-8-16/h7,17-19,22H,2-6,8-15H2,1H3,(H,21,24)/t18-,19+/m0/s1 |
| InChIKey | VLTIORNOHUZGMB-RBUKOAKNSA-N |
| XLogP | 2.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|