About 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea
1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea (PubChem CID 99696330) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea.
Molecular Properties
| Compound Name | 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea |
| PubChem CID | 99696330 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea |
| SMILES | O=C(Nc1cccnn1)N[C@@H](c1ccccc1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C21H20N4O2/c26-21(23-19-9-4-12-22-25-19)24-20(15-6-2-1-3-7-15)17-10-11-18-16(14-17)8-5-13-27-18/h1-4,6-7,9-12,14,20H,5,8,13H2,(H2,23,24,25,26)/t20-/m0/s1 |
| InChIKey | GSTGWBSCMFOSMP-FQEVSTJZSA-N |
| XLogP | 3.71 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea?
The IUPAC name of 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea (CID 99696330) is 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea.
What is the SMILES notation for 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea?
The canonical SMILES for 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea is O=C(Nc1cccnn1)N[C@@H](c1ccccc1)c1ccc2c(c1)CCCO2.
What is the InChIKey of 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea?
The InChIKey is GSTGWBSCMFOSMP-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H20N4O2/c26-21(23-19-9-4-12-22-25-19)24-20(15-6-2-1-3-7-15)17-10-11-18-16(14-17)8-5-13-27-18/h1-4,6-7,9-12,14,20H,5,8,13H2,(H2,23,24,25,26)/t20-/m0/s1.
What are the key properties of 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea?
1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea has a molecular weight of 360.42 g/mol, XLogP of 3.71, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(S)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]-3-pyridazin-3-ylurea is sourced from PubChem (CID 99696330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).