C15H16Cl2N4O2S — CID 99696655
3,5-dichloro-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-4-methoxybenzamide (PubChem CID 99696655) has the molecular formula C15H16Cl2N4O2S and a molecular weight of 387.29 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 99696655 |
| Molecular Formula | C15H16Cl2N4O2S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 3,5-dichloro-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NCCn2c(C3CC3)n[nH]c2=S)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N4O2S/c1-23-12-10(16)6-9(7-11(12)17)14(22)18-4-5-21-13(8-2-3-8)19-20-15(21)24/h6-8H,2-5H2,1H3,(H,18,22)(H,20,24) |
| InChIKey | RVGYBEQFASECHZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|