C13H25NOS — CID 99696844
N-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-3-[(S)-methylsulfinyl]propan-1-amine (PubChem CID 99696844) has the molecular formula C13H25NOS and a molecular weight of 243.42 g/mol. Its IUPAC name is N-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-3-[(S)-methylsulfinyl]propan-1-amine.
| Compound Name | N-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-3-[(S)-methylsulfinyl]propan-1-amine |
|---|---|
| PubChem CID | 99696844 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-3-[(S)-methylsulfinyl]propan-1-amine |
| SMILES | CC1=CCC[C@@H](C)[C@H]1CNCCC[S@](C)=O |
| InChI | InChI=1S/C13H25NOS/c1-11-6-4-7-12(2)13(11)10-14-8-5-9-16(3)15/h6,12-14H,4-5,7-10H2,1-3H3/t12-,13+,16+/m1/s1 |
| InChIKey | HWQPBNPAKZEJAL-WWGRRREGSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|