C15H24N4O — CID 99696909
3-[3-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]pyrazol-1-yl]propanamide (PubChem CID 99696909) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[3-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]pyrazol-1-yl]propanamide.
| Compound Name | 3-[3-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 99696909 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 3-[3-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]pyrazol-1-yl]propanamide |
| SMILES | CC1=CCC[C@@H](C)[C@H]1CNc1ccn(CCC(N)=O)n1 |
| InChI | InChI=1S/C15H24N4O/c1-11-4-3-5-12(2)13(11)10-17-15-7-9-19(18-15)8-6-14(16)20/h4,7,9,12-13H,3,5-6,8,10H2,1-2H3,(H2,16,20)(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | SRFFQABBUQQCDU-OLZOCXBDSA-N |
| XLogP | 2.16 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|